2-(2-fluorophenyl)-1-(4-methylbenzene-1-sulfonyl)pyrrolidine
Chemical Structure Depiction of
2-(2-fluorophenyl)-1-(4-methylbenzene-1-sulfonyl)pyrrolidine
2-(2-fluorophenyl)-1-(4-methylbenzene-1-sulfonyl)pyrrolidine
Compound characteristics
| Compound ID: | D399-0507 |
| Compound Name: | 2-(2-fluorophenyl)-1-(4-methylbenzene-1-sulfonyl)pyrrolidine |
| Molecular Weight: | 319.4 |
| Molecular Formula: | C17 H18 F N O2 S |
| Smiles: | Cc1ccc(cc1)S(N1CCCC1c1ccccc1F)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9007 |
| logD: | 3.9007 |
| logSw: | -3.8035 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.515 |
| InChI Key: | IDMSTPZAGKIQPI-KRWDZBQOSA-N |