1-(2,5-dimethylbenzene-1-sulfonyl)-2-(4-fluorophenyl)pyrrolidine
Chemical Structure Depiction of
1-(2,5-dimethylbenzene-1-sulfonyl)-2-(4-fluorophenyl)pyrrolidine
1-(2,5-dimethylbenzene-1-sulfonyl)-2-(4-fluorophenyl)pyrrolidine
Compound characteristics
| Compound ID: | D399-0644 |
| Compound Name: | 1-(2,5-dimethylbenzene-1-sulfonyl)-2-(4-fluorophenyl)pyrrolidine |
| Molecular Weight: | 333.42 |
| Molecular Formula: | C18 H20 F N O2 S |
| Smiles: | Cc1ccc(C)c(c1)S(N1CCCC1c1ccc(cc1)F)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.132 |
| logD: | 4.132 |
| logSw: | -4.076 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.515 |
| InChI Key: | CMKDLOANLGHPII-KRWDZBQOSA-N |