1-(morpholin-4-yl)-2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)phenoxy]ethan-1-one
Chemical Structure Depiction of
1-(morpholin-4-yl)-2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)phenoxy]ethan-1-one
1-(morpholin-4-yl)-2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)phenoxy]ethan-1-one
Compound characteristics
| Compound ID: | D400-0007 |
| Compound Name: | 1-(morpholin-4-yl)-2-[3-(3-phenyl-1,2,4-oxadiazol-5-yl)phenoxy]ethan-1-one |
| Molecular Weight: | 365.39 |
| Molecular Formula: | C20 H19 N3 O4 |
| Smiles: | C1COCCN1C(COc1cccc(c1)c1nc(c2ccccc2)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6418 |
| logD: | 2.6418 |
| logSw: | -3.0026 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 63.173 |
| InChI Key: | OIXNCAWJPBKHAP-UHFFFAOYSA-N |