2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenoxy]-N-[2-(propan-2-yl)phenyl]acetamide
Chemical Structure Depiction of
2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenoxy]-N-[2-(propan-2-yl)phenyl]acetamide
2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenoxy]-N-[2-(propan-2-yl)phenyl]acetamide
Compound characteristics
| Compound ID: | D400-1037 |
| Compound Name: | 2-[4-(3-ethyl-1,2,4-oxadiazol-5-yl)phenoxy]-N-[2-(propan-2-yl)phenyl]acetamide |
| Molecular Weight: | 365.43 |
| Molecular Formula: | C21 H23 N3 O3 |
| Smiles: | CCc1nc(c2ccc(cc2)OCC(Nc2ccccc2C(C)C)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.2323 |
| logD: | 4.2323 |
| logSw: | -4.1443 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.585 |
| InChI Key: | BBSHZVSDVRHQKW-UHFFFAOYSA-N |