N-{2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl}benzamide
Chemical Structure Depiction of
N-{2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl}benzamide
N-{2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl}benzamide
Compound characteristics
| Compound ID: | D400-1438 |
| Compound Name: | N-{2-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl}benzamide |
| Molecular Weight: | 355.39 |
| Molecular Formula: | C22 H17 N3 O2 |
| Smiles: | Cc1ccc(cc1)c1nc(c2ccccc2NC(c2ccccc2)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 5.2809 |
| logD: | 5.2809 |
| logSw: | -5.2271 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.038 |
| InChI Key: | HSGZHFZAWWGKFP-UHFFFAOYSA-N |