N-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-2-fluorobenzamide
Chemical Structure Depiction of
N-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-2-fluorobenzamide
N-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-2-fluorobenzamide
Compound characteristics
| Compound ID: | D400-1731 |
| Compound Name: | N-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-2-fluorobenzamide |
| Molecular Weight: | 311.31 |
| Molecular Formula: | C17 H14 F N3 O2 |
| Smiles: | CCc1nc(c2ccccc2NC(c2ccccc2F)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.4929 |
| logD: | 3.4928 |
| logSw: | -3.8005 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.3 |
| InChI Key: | FKXPAQDFIFPLFW-UHFFFAOYSA-N |