N-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide
Chemical Structure Depiction of
N-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide
N-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide
Compound characteristics
| Compound ID: | D400-1753 |
| Compound Name: | N-[2-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-1-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
| Molecular Weight: | 390.44 |
| Molecular Formula: | C22 H22 N4 O3 |
| Smiles: | CCc1nc(c2ccccc2NC(C2CC(N(C2)c2ccc(C)cc2)=O)=O)on1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2713 |
| logD: | 3.2713 |
| logSw: | -3.4941 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.05 |
| InChI Key: | QAWCQOIUJOKWKT-OAHLLOKOSA-N |