methyl 4-oxo-4-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)anilino]butanoate
Chemical Structure Depiction of
methyl 4-oxo-4-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)anilino]butanoate
methyl 4-oxo-4-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)anilino]butanoate
Compound characteristics
| Compound ID: | D400-2451 |
| Compound Name: | methyl 4-oxo-4-[4-(3-phenyl-1,2,4-oxadiazol-5-yl)anilino]butanoate |
| Molecular Weight: | 351.36 |
| Molecular Formula: | C19 H17 N3 O4 |
| Smiles: | COC(CCC(Nc1ccc(cc1)c1nc(c2ccccc2)no1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.268 |
| logD: | 3.268 |
| logSw: | -3.5246 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.372 |
| InChI Key: | GECSKAGOICQPDF-UHFFFAOYSA-N |