4-methoxy-N-{4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl}benzamide
					Chemical Structure Depiction of
4-methoxy-N-{4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl}benzamide
			4-methoxy-N-{4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl}benzamide
Compound characteristics
| Compound ID: | D400-2768 | 
| Compound Name: | 4-methoxy-N-{4-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]phenyl}benzamide | 
| Molecular Weight: | 401.42 | 
| Molecular Formula: | C23 H19 N3 O4 | 
| Smiles: | COc1ccc(cc1)C(Nc1ccc(cc1)c1nc(c2ccc(cc2)OC)no1)=O | 
| Stereo: | ACHIRAL | 
| logP: | 5.0077 | 
| logD: | 5.0077 | 
| logSw: | -4.6607 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 69.823 | 
| InChI Key: | PYBLISKZLZMNSO-UHFFFAOYSA-N | 
 
				 
				