N-methyl-2-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy}-N-phenylbenzamide
Chemical Structure Depiction of
N-methyl-2-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy}-N-phenylbenzamide
N-methyl-2-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy}-N-phenylbenzamide
Compound characteristics
| Compound ID: | D400-3190 |
| Compound Name: | N-methyl-2-{[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methoxy}-N-phenylbenzamide |
| Molecular Weight: | 399.45 |
| Molecular Formula: | C24 H21 N3 O3 |
| Smiles: | Cc1ccc(cc1)c1nc(COc2ccccc2C(N(C)c2ccccc2)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.8239 |
| logD: | 4.8239 |
| logSw: | -4.6526 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.265 |
| InChI Key: | JJVDVEWENATRRD-UHFFFAOYSA-N |