1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[2-methoxy-4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenoxy]ethan-1-one
Chemical Structure Depiction of
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[2-methoxy-4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenoxy]ethan-1-one
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[2-methoxy-4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenoxy]ethan-1-one
Compound characteristics
| Compound ID: | D400-3705 |
| Compound Name: | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[2-methoxy-4-(5-phenyl-1,2,4-oxadiazol-3-yl)phenoxy]ethan-1-one |
| Molecular Weight: | 488.52 |
| Molecular Formula: | C27 H25 F N4 O4 |
| Smiles: | COc1cc(ccc1OCC(N1CCN(CC1)c1ccc(cc1)F)=O)c1nc(c2ccccc2)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.3351 |
| logD: | 4.3351 |
| logSw: | -4.4141 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 66.242 |
| InChI Key: | WCPBPOSGJCKWSP-UHFFFAOYSA-N |