N-ethyl-4-[(2-phenylimidazo[1,2-a]pyrazin-3-yl)amino]benzamide
Chemical Structure Depiction of
N-ethyl-4-[(2-phenylimidazo[1,2-a]pyrazin-3-yl)amino]benzamide
N-ethyl-4-[(2-phenylimidazo[1,2-a]pyrazin-3-yl)amino]benzamide
Compound characteristics
| Compound ID: | D401-0149 |
| Compound Name: | N-ethyl-4-[(2-phenylimidazo[1,2-a]pyrazin-3-yl)amino]benzamide |
| Molecular Weight: | 357.41 |
| Molecular Formula: | C21 H19 N5 O |
| Smiles: | CCNC(c1ccc(cc1)Nc1c(c2ccccc2)nc2cnccn12)=O |
| Stereo: | ACHIRAL |
| logP: | 2.6557 |
| logD: | 2.6555 |
| logSw: | -3.0201 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.507 |
| InChI Key: | OHTVXAQWJGLCAZ-UHFFFAOYSA-N |