ethyl 4-{[2-(3-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate
Chemical Structure Depiction of
ethyl 4-{[2-(3-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate
ethyl 4-{[2-(3-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate
Compound characteristics
| Compound ID: | D401-0744 |
| Compound Name: | ethyl 4-{[2-(3-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoate |
| Molecular Weight: | 374.4 |
| Molecular Formula: | C21 H18 N4 O3 |
| Smiles: | CCOC(c1ccc(cc1)Nc1c(c2cccc(c2)O)nc2cnccn12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9195 |
| logD: | 3.9172 |
| logSw: | -3.5806 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.567 |
| InChI Key: | YIHJKRCXEFATIM-UHFFFAOYSA-N |