4-{[2-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoic acid
Chemical Structure Depiction of
4-{[2-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoic acid
4-{[2-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoic acid
Compound characteristics
| Compound ID: | D401-0746 |
| Compound Name: | 4-{[2-(4-methoxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoic acid |
| Molecular Weight: | 360.37 |
| Molecular Formula: | C20 H16 N4 O3 |
| Smiles: | COc1ccc(cc1)c1c(Nc2ccc(cc2)C(O)=O)n2ccncc2n1 |
| Stereo: | ACHIRAL |
| logP: | 3.4552 |
| logD: | 1.06 |
| logSw: | -3.4168 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.149 |
| InChI Key: | USHJANSTZDPAMN-UHFFFAOYSA-N |