4-{[2-(5-bromo-2-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoic acid
Chemical Structure Depiction of
4-{[2-(5-bromo-2-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoic acid
4-{[2-(5-bromo-2-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoic acid
Compound characteristics
| Compound ID: | D401-0759 |
| Compound Name: | 4-{[2-(5-bromo-2-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]amino}benzoic acid |
| Molecular Weight: | 425.24 |
| Molecular Formula: | C19 H13 Br N4 O3 |
| Smiles: | c1cc(ccc1C(O)=O)Nc1c(c2cc(ccc2O)[Br])nc2cnccn12 |
| Stereo: | ACHIRAL |
| logP: | 4.631 |
| logD: | 2.2358 |
| logSw: | -4.1805 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 72.153 |
| InChI Key: | NBEQMTJNRSGAQM-UHFFFAOYSA-N |