9-(4-tert-butylphenyl)-8-(4-nitrophenyl)-4,9-dihydrotetrazolo[1',5':1,2]pyrimido[4,5-d]pyridazin-5-ol
Chemical Structure Depiction of
9-(4-tert-butylphenyl)-8-(4-nitrophenyl)-4,9-dihydrotetrazolo[1',5':1,2]pyrimido[4,5-d]pyridazin-5-ol
9-(4-tert-butylphenyl)-8-(4-nitrophenyl)-4,9-dihydrotetrazolo[1',5':1,2]pyrimido[4,5-d]pyridazin-5-ol
Compound characteristics
| Compound ID: | D402-0078 |
| Compound Name: | 9-(4-tert-butylphenyl)-8-(4-nitrophenyl)-4,9-dihydrotetrazolo[1',5':1,2]pyrimido[4,5-d]pyridazin-5-ol |
| Molecular Weight: | 444.45 |
| Molecular Formula: | C22 H20 N8 O3 |
| Smiles: | CC(C)(C)c1ccc(cc1)C1c2c(c(nnc2c2ccc(cc2)[N+]([O-])=O)O)Nc2nnnn12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6976 |
| logD: | 3.6976 |
| logSw: | -3.9241 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 123.147 |
| InChI Key: | ROAXGAKSZGCDNG-IBGZPJMESA-N |