8-(3,4-dimethoxyphenyl)-9-(2-fluorophenyl)-4,9-dihydrotetrazolo[1',5':1,2]pyrimido[4,5-d]pyridazin-5-ol
Chemical Structure Depiction of
8-(3,4-dimethoxyphenyl)-9-(2-fluorophenyl)-4,9-dihydrotetrazolo[1',5':1,2]pyrimido[4,5-d]pyridazin-5-ol
8-(3,4-dimethoxyphenyl)-9-(2-fluorophenyl)-4,9-dihydrotetrazolo[1',5':1,2]pyrimido[4,5-d]pyridazin-5-ol
Compound characteristics
| Compound ID: | D402-0163 |
| Compound Name: | 8-(3,4-dimethoxyphenyl)-9-(2-fluorophenyl)-4,9-dihydrotetrazolo[1',5':1,2]pyrimido[4,5-d]pyridazin-5-ol |
| Molecular Weight: | 421.39 |
| Molecular Formula: | C20 H16 F N7 O3 |
| Smiles: | COc1ccc(cc1OC)c1c2C(c3ccccc3F)n3c(Nc2c(nn1)O)nnn3 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.8748 |
| logD: | 1.8748 |
| logSw: | -2.456 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 105.026 |
| InChI Key: | BVWLNQYPNHAFQH-SFHVURJKSA-N |