{4-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]piperazin-1-yl}(3-fluorophenyl)methanone
Chemical Structure Depiction of
{4-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]piperazin-1-yl}(3-fluorophenyl)methanone
{4-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]piperazin-1-yl}(3-fluorophenyl)methanone
Compound characteristics
| Compound ID: | D403-0012 |
| Compound Name: | {4-[4-(benzenesulfonyl)-2-phenyl-1,3-oxazol-5-yl]piperazin-1-yl}(3-fluorophenyl)methanone |
| Molecular Weight: | 491.54 |
| Molecular Formula: | C26 H22 F N3 O4 S |
| Smiles: | C1CN(CCN1C(c1cccc(c1)F)=O)c1c(nc(c2ccccc2)o1)S(c1ccccc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1699 |
| logD: | 4.1699 |
| logSw: | -4.2858 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 67.935 |
| InChI Key: | KTPKDMYOIHOJKS-UHFFFAOYSA-N |