1-{4-[2-(3-chlorophenyl)-4-(4-methylbenzene-1-sulfonyl)-1,3-oxazol-5-yl]piperazin-1-yl}ethan-1-one
Chemical Structure Depiction of
1-{4-[2-(3-chlorophenyl)-4-(4-methylbenzene-1-sulfonyl)-1,3-oxazol-5-yl]piperazin-1-yl}ethan-1-one
1-{4-[2-(3-chlorophenyl)-4-(4-methylbenzene-1-sulfonyl)-1,3-oxazol-5-yl]piperazin-1-yl}ethan-1-one
Compound characteristics
| Compound ID: | D403-0937 |
| Compound Name: | 1-{4-[2-(3-chlorophenyl)-4-(4-methylbenzene-1-sulfonyl)-1,3-oxazol-5-yl]piperazin-1-yl}ethan-1-one |
| Molecular Weight: | 459.95 |
| Molecular Formula: | C22 H22 Cl N3 O4 S |
| Smiles: | CC(N1CCN(CC1)c1c(nc(c2cccc(c2)[Cl])o1)S(c1ccc(C)cc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2782 |
| logD: | 4.2782 |
| logSw: | -4.5349 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 68.674 |
| InChI Key: | DQHPCQRXOGWUCW-UHFFFAOYSA-N |