1-{4-[2-(furan-2-yl)-4-(4-methylbenzene-1-sulfonyl)-1,3-oxazol-5-yl]piperazin-1-yl}ethan-1-one
Chemical Structure Depiction of
1-{4-[2-(furan-2-yl)-4-(4-methylbenzene-1-sulfonyl)-1,3-oxazol-5-yl]piperazin-1-yl}ethan-1-one
1-{4-[2-(furan-2-yl)-4-(4-methylbenzene-1-sulfonyl)-1,3-oxazol-5-yl]piperazin-1-yl}ethan-1-one
Compound characteristics
| Compound ID: | D404-0162 |
| Compound Name: | 1-{4-[2-(furan-2-yl)-4-(4-methylbenzene-1-sulfonyl)-1,3-oxazol-5-yl]piperazin-1-yl}ethan-1-one |
| Molecular Weight: | 415.47 |
| Molecular Formula: | C20 H21 N3 O5 S |
| Smiles: | CC(N1CCN(CC1)c1c(nc(c2ccco2)o1)S(c1ccc(C)cc1)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7995 |
| logD: | 2.7995 |
| logSw: | -3.231 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 77.253 |
| InChI Key: | ZHMGWAYCACBMRJ-UHFFFAOYSA-N |