N-{3-[(3-bromophenyl)(morpholin-4-yl)methyl]-5-ethylthiophen-2-yl}furan-2-carboxamide
Chemical Structure Depiction of
N-{3-[(3-bromophenyl)(morpholin-4-yl)methyl]-5-ethylthiophen-2-yl}furan-2-carboxamide
N-{3-[(3-bromophenyl)(morpholin-4-yl)methyl]-5-ethylthiophen-2-yl}furan-2-carboxamide
Compound characteristics
| Compound ID: | D411-0176 |
| Compound Name: | N-{3-[(3-bromophenyl)(morpholin-4-yl)methyl]-5-ethylthiophen-2-yl}furan-2-carboxamide |
| Molecular Weight: | 475.4 |
| Molecular Formula: | C22 H23 Br N2 O3 S |
| Smiles: | CCc1cc(C(c2cccc(c2)[Br])N2CCOCC2)c(NC(c2ccco2)=O)s1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.072 |
| logD: | 4.7723 |
| logSw: | -4.6722 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.364 |
| InChI Key: | BBDUMNUATYRIKZ-HXUWFJFHSA-N |