N-{3-[(4-bromophenyl)(morpholin-4-yl)methyl]-4,5-dimethylthiophen-2-yl}thiophene-2-carboxamide
Chemical Structure Depiction of
N-{3-[(4-bromophenyl)(morpholin-4-yl)methyl]-4,5-dimethylthiophen-2-yl}thiophene-2-carboxamide
N-{3-[(4-bromophenyl)(morpholin-4-yl)methyl]-4,5-dimethylthiophen-2-yl}thiophene-2-carboxamide
Compound characteristics
| Compound ID: | D411-0235 |
| Compound Name: | N-{3-[(4-bromophenyl)(morpholin-4-yl)methyl]-4,5-dimethylthiophen-2-yl}thiophene-2-carboxamide |
| Molecular Weight: | 491.47 |
| Molecular Formula: | C22 H23 Br N2 O2 S2 |
| Smiles: | Cc1c(C(c2ccc(cc2)[Br])N2CCOCC2)c(NC(c2cccs2)=O)sc1C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6206 |
| logD: | 5.5979 |
| logSw: | -5.3983 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.804 |
| InChI Key: | FYLCDNQEKXIIOT-HXUWFJFHSA-N |