7-fluoro-1-(3-hydroxyphenyl)-2-[3-(morpholin-4-yl)propyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
7-fluoro-1-(3-hydroxyphenyl)-2-[3-(morpholin-4-yl)propyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
7-fluoro-1-(3-hydroxyphenyl)-2-[3-(morpholin-4-yl)propyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | D417-0205 |
| Compound Name: | 7-fluoro-1-(3-hydroxyphenyl)-2-[3-(morpholin-4-yl)propyl]-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 438.45 |
| Molecular Formula: | C24 H23 F N2 O5 |
| Smiles: | C(CN1CCOCC1)CN1C(C2=C(C1=O)Oc1ccc(cc1C2=O)F)c1cccc(c1)O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4459 |
| logD: | 2.2602 |
| logSw: | -2.8076 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.219 |
| InChI Key: | AXKVJTFILDQATN-OAQYLSRUSA-N |