6-(3-bromo-4-methoxyphenyl)-3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine
Chemical Structure Depiction of
6-(3-bromo-4-methoxyphenyl)-3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine
6-(3-bromo-4-methoxyphenyl)-3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine
Compound characteristics
| Compound ID: | D423-0119 |
| Compound Name: | 6-(3-bromo-4-methoxyphenyl)-3-methyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| Molecular Weight: | 339.21 |
| Molecular Formula: | C12 H11 Br N4 O S |
| Smiles: | Cc1nnc2n1N=C(CS2)c1ccc(c(c1)[Br])OC |
| Stereo: | ACHIRAL |
| logP: | 2.5705 |
| logD: | 2.5596 |
| logSw: | -2.6655 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 42.637 |
| InChI Key: | PTCHCKZLWNMEMC-UHFFFAOYSA-N |