1-(5-fluoro-1H-indol-3-yl)-2-[4-(2-fluorophenyl)piperazin-1-yl]ethan-1-ol
Chemical Structure Depiction of
1-(5-fluoro-1H-indol-3-yl)-2-[4-(2-fluorophenyl)piperazin-1-yl]ethan-1-ol
1-(5-fluoro-1H-indol-3-yl)-2-[4-(2-fluorophenyl)piperazin-1-yl]ethan-1-ol
Compound characteristics
| Compound ID: | D424-0122 |
| Compound Name: | 1-(5-fluoro-1H-indol-3-yl)-2-[4-(2-fluorophenyl)piperazin-1-yl]ethan-1-ol |
| Molecular Weight: | 357.4 |
| Molecular Formula: | C20 H21 F2 N3 O |
| Smiles: | C1CN(CCN1CC(c1c[nH]c2ccc(cc12)F)O)c1ccccc1F |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1509 |
| logD: | 3.1393 |
| logSw: | -3.1636 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 32.953 |
| InChI Key: | FBWWIKUJQFYPSR-FQEVSTJZSA-N |