N,3-bis(4-methylphenyl)-1-oxo-3,4-dihydro-1H-2-benzopyran-6-carboxamide
Chemical Structure Depiction of
N,3-bis(4-methylphenyl)-1-oxo-3,4-dihydro-1H-2-benzopyran-6-carboxamide
N,3-bis(4-methylphenyl)-1-oxo-3,4-dihydro-1H-2-benzopyran-6-carboxamide
Compound characteristics
| Compound ID: | D429-0006 |
| Compound Name: | N,3-bis(4-methylphenyl)-1-oxo-3,4-dihydro-1H-2-benzopyran-6-carboxamide |
| Molecular Weight: | 371.43 |
| Molecular Formula: | C24 H21 N O3 |
| Smiles: | Cc1ccc(cc1)C1Cc2cc(ccc2C(=O)O1)C(Nc1ccc(C)cc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.4181 |
| logD: | 5.4177 |
| logSw: | -5.497 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.882 |
| InChI Key: | RVBQNSMGGSSPLO-QFIPXVFZSA-N |