(4-tert-butylphenyl){4-[2-methyl-6-(morpholin-4-yl)pyrimidin-4-yl]piperazin-1-yl}methanone
Chemical Structure Depiction of
(4-tert-butylphenyl){4-[2-methyl-6-(morpholin-4-yl)pyrimidin-4-yl]piperazin-1-yl}methanone
(4-tert-butylphenyl){4-[2-methyl-6-(morpholin-4-yl)pyrimidin-4-yl]piperazin-1-yl}methanone
Compound characteristics
| Compound ID: | D430-0180 |
| Compound Name: | (4-tert-butylphenyl){4-[2-methyl-6-(morpholin-4-yl)pyrimidin-4-yl]piperazin-1-yl}methanone |
| Molecular Weight: | 423.56 |
| Molecular Formula: | C24 H33 N5 O2 |
| Smiles: | Cc1nc(cc(n1)N1CCOCC1)N1CCN(CC1)C(c1ccc(cc1)C(C)(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4418 |
| logD: | 4.4154 |
| logSw: | -4.289 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.619 |
| InChI Key: | NXDCSLJYSQZDKA-UHFFFAOYSA-N |