{4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl}[3-(trifluoromethyl)phenyl]methanone
Chemical Structure Depiction of
{4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl}[3-(trifluoromethyl)phenyl]methanone
{4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl}[3-(trifluoromethyl)phenyl]methanone
Compound characteristics
| Compound ID: | D430-0255 |
| Compound Name: | {4-[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]piperazin-1-yl}[3-(trifluoromethyl)phenyl]methanone |
| Molecular Weight: | 455.48 |
| Molecular Formula: | C24 H24 F3 N5 O |
| Smiles: | Cc1ccc(cc1)Nc1cc(nc(C)n1)N1CCN(CC1)C(c1cccc(c1)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.147 |
| logD: | 4.6309 |
| logSw: | -5.1473 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.274 |
| InChI Key: | HWDZDSHWLCHHLY-UHFFFAOYSA-N |