3-bromo-N-(4-{[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino}phenyl)benzamide
Chemical Structure Depiction of
3-bromo-N-(4-{[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino}phenyl)benzamide
3-bromo-N-(4-{[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino}phenyl)benzamide
Compound characteristics
| Compound ID: | D430-0303 |
| Compound Name: | 3-bromo-N-(4-{[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino}phenyl)benzamide |
| Molecular Weight: | 426.31 |
| Molecular Formula: | C20 H20 Br N5 O |
| Smiles: | Cc1nc(cc(n1)N(C)C)Nc1ccc(cc1)NC(c1cccc(c1)[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 4.7982 |
| logD: | 3.5412 |
| logSw: | -4.6222 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.261 |
| InChI Key: | PIUSDXCFFOKNTG-UHFFFAOYSA-N |