N-(4-chlorophenyl)-N-[(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-2-phenylbutanamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-N-[(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-2-phenylbutanamide
N-(4-chlorophenyl)-N-[(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-2-phenylbutanamide
Compound characteristics
| Compound ID: | D433-0237 |
| Compound Name: | N-(4-chlorophenyl)-N-[(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-2-phenylbutanamide |
| Molecular Weight: | 433.94 |
| Molecular Formula: | C24 H24 Cl N5 O |
| Smiles: | CCC(C(N(Cc1nc2nc(C)cc(C)n2n1)c1ccc(cc1)[Cl])=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5301 |
| logD: | 4.5301 |
| logSw: | -4.7112 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.171 |
| InChI Key: | ZLJPPCBGRJUKAS-OAQYLSRUSA-N |