N-[(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4-methoxy-N-(3-methylphenyl)benzamide
Chemical Structure Depiction of
N-[(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4-methoxy-N-(3-methylphenyl)benzamide
N-[(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4-methoxy-N-(3-methylphenyl)benzamide
Compound characteristics
| Compound ID: | D433-0268 |
| Compound Name: | N-[(5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4-methoxy-N-(3-methylphenyl)benzamide |
| Molecular Weight: | 401.47 |
| Molecular Formula: | C23 H23 N5 O2 |
| Smiles: | Cc1cccc(c1)N(Cc1nc2nc(C)cc(C)n2n1)C(c1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3698 |
| logD: | 3.3698 |
| logSw: | -3.4214 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.715 |
| InChI Key: | SQTFQCGABHBOCA-UHFFFAOYSA-N |