N-[(6-chloro-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4-methoxyaniline
Chemical Structure Depiction of
N-[(6-chloro-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4-methoxyaniline
N-[(6-chloro-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4-methoxyaniline
Compound characteristics
| Compound ID: | D433-0701 |
| Compound Name: | N-[(6-chloro-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4-methoxyaniline |
| Molecular Weight: | 317.78 |
| Molecular Formula: | C15 H16 Cl N5 O |
| Smiles: | Cc1c(c(C)n2c(n1)nc(CNc1ccc(cc1)OC)n2)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 2.661 |
| logD: | 2.6608 |
| logSw: | -3.8402 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.145 |
| InChI Key: | KKGFMMNWUQLKRE-UHFFFAOYSA-N |