[4-(5,7-diphenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl](2-fluorophenyl)methanone
Chemical Structure Depiction of
[4-(5,7-diphenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl](2-fluorophenyl)methanone
[4-(5,7-diphenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl](2-fluorophenyl)methanone
Compound characteristics
| Compound ID: | D434-0009 |
| Compound Name: | [4-(5,7-diphenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl](2-fluorophenyl)methanone |
| Molecular Weight: | 477.54 |
| Molecular Formula: | C29 H24 F N5 O |
| Smiles: | C1CN(CCN1C(c1ccccc1F)=O)c1c2c(cn(c3ccccc3)c2ncn1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.4562 |
| logD: | 5.3483 |
| logSw: | -5.7927 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 42.668 |
| InChI Key: | HPPDEOJZSXDRFD-UHFFFAOYSA-N |