1-{4-[7-(2-chlorophenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl}-2-(2-fluorophenoxy)ethan-1-one
Chemical Structure Depiction of
1-{4-[7-(2-chlorophenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl}-2-(2-fluorophenoxy)ethan-1-one
1-{4-[7-(2-chlorophenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl}-2-(2-fluorophenoxy)ethan-1-one
Compound characteristics
| Compound ID: | D434-0326 |
| Compound Name: | 1-{4-[7-(2-chlorophenyl)-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperazin-1-yl}-2-(2-fluorophenoxy)ethan-1-one |
| Molecular Weight: | 542.01 |
| Molecular Formula: | C30 H25 Cl F N5 O2 |
| Smiles: | C1CN(CCN1C(COc1ccccc1F)=O)c1c2c(cn(c3ccccc3[Cl])c2ncn1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.6923 |
| logD: | 5.5845 |
| logSw: | -5.9431 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 49.426 |
| InChI Key: | LTUUROKUQJXMEO-UHFFFAOYSA-N |