4-(4-cyano-5-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-1,3-oxazol-2-yl)-N,N-dimethylbenzene-1-sulfonamide
Chemical Structure Depiction of
4-(4-cyano-5-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-1,3-oxazol-2-yl)-N,N-dimethylbenzene-1-sulfonamide
4-(4-cyano-5-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-1,3-oxazol-2-yl)-N,N-dimethylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | D434-0539 |
| Compound Name: | 4-(4-cyano-5-{[2-(3,4-dimethoxyphenyl)ethyl]amino}-1,3-oxazol-2-yl)-N,N-dimethylbenzene-1-sulfonamide |
| Molecular Weight: | 456.52 |
| Molecular Formula: | C22 H24 N4 O5 S |
| Smiles: | CN(C)S(c1ccc(cc1)c1nc(C#N)c(NCCc2ccc(c(c2)OC)OC)o1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3713 |
| logD: | 2.3713 |
| logSw: | -2.9131 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 95.044 |
| InChI Key: | RKMMFNBPOIGGGG-UHFFFAOYSA-N |