1-(4-chlorophenyl)-N-{2-[2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl}ethan-1-amine
Chemical Structure Depiction of
1-(4-chlorophenyl)-N-{2-[2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl}ethan-1-amine
1-(4-chlorophenyl)-N-{2-[2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl}ethan-1-amine
Compound characteristics
| Compound ID: | D442-0249 |
| Compound Name: | 1-(4-chlorophenyl)-N-{2-[2,2-dimethyl-4-(3-methylbutyl)oxan-4-yl]ethyl}ethan-1-amine |
| Molecular Weight: | 365.99 |
| Molecular Formula: | C22 H36 Cl N O |
| Smiles: | CC(C)CCC1(CCNC(C)c2ccc(cc2)[Cl])CCOC(C)(C)C1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.8788 |
| logD: | 5.0518 |
| logSw: | -6.42 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 18.1908 |
| InChI Key: | CODQGSPQNINKTM-UHFFFAOYSA-N |