N-(4-ethylphenyl)-7-methoxy-1-benzoxepine-4-carboxamide
Chemical Structure Depiction of
N-(4-ethylphenyl)-7-methoxy-1-benzoxepine-4-carboxamide
N-(4-ethylphenyl)-7-methoxy-1-benzoxepine-4-carboxamide
Compound characteristics
| Compound ID: | D443-0759 |
| Compound Name: | N-(4-ethylphenyl)-7-methoxy-1-benzoxepine-4-carboxamide |
| Molecular Weight: | 321.37 |
| Molecular Formula: | C20 H19 N O3 |
| Smiles: | CCc1ccc(cc1)NC(C1C=COc2ccc(cc2C=1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0161 |
| logD: | 5.0161 |
| logSw: | -4.6877 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.498 |
| InChI Key: | OVZCKTNWRMPYEY-UHFFFAOYSA-N |