N-(4-butylphenyl)-7-methoxy-1-benzoxepine-4-carboxamide
Chemical Structure Depiction of
N-(4-butylphenyl)-7-methoxy-1-benzoxepine-4-carboxamide
N-(4-butylphenyl)-7-methoxy-1-benzoxepine-4-carboxamide
Compound characteristics
| Compound ID: | D443-0851 |
| Compound Name: | N-(4-butylphenyl)-7-methoxy-1-benzoxepine-4-carboxamide |
| Molecular Weight: | 349.43 |
| Molecular Formula: | C22 H23 N O3 |
| Smiles: | CCCCc1ccc(cc1)NC(C1C=COc2ccc(cc2C=1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 6.0546 |
| logD: | 6.0546 |
| logSw: | -5.4098 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.498 |
| InChI Key: | QOZNXTOJTZUIDM-UHFFFAOYSA-N |