1-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]-N-(2,4-dimethoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide
					Chemical Structure Depiction of
1-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]-N-(2,4-dimethoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide
			1-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]-N-(2,4-dimethoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | D443-1853 | 
| Compound Name: | 1-[3-(4-chlorophenyl)-2,1-benzoxazol-5-yl]-N-(2,4-dimethoxyphenyl)-5-methyl-1H-1,2,3-triazole-4-carboxamide | 
| Molecular Weight: | 489.92 | 
| Molecular Formula: | C25 H20 Cl N5 O4 | 
| Smiles: | Cc1c(C(Nc2ccc(cc2OC)OC)=O)nnn1c1ccc2c(c1)c(c1ccc(cc1)[Cl])on2 | 
| Stereo: | ACHIRAL | 
| logP: | 5.2467 | 
| logD: | 5.2427 | 
| logSw: | -5.8546 | 
| Hydrogen bond acceptors count: | 8 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 86.132 | 
| InChI Key: | HJNTUCPHRNMGHO-UHFFFAOYSA-N | 
 
				 
				