3-(4-benzylpiperidine-1-carbonyl)-1H-2-benzothiopyran-1-one
Chemical Structure Depiction of
3-(4-benzylpiperidine-1-carbonyl)-1H-2-benzothiopyran-1-one
3-(4-benzylpiperidine-1-carbonyl)-1H-2-benzothiopyran-1-one
Compound characteristics
| Compound ID: | D443-2486 |
| Compound Name: | 3-(4-benzylpiperidine-1-carbonyl)-1H-2-benzothiopyran-1-one |
| Molecular Weight: | 363.48 |
| Molecular Formula: | C22 H21 N O2 S |
| Smiles: | C1CN(CCC1Cc1ccccc1)C(C1=Cc2ccccc2C(=O)S1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.8579 |
| logD: | 4.8579 |
| logSw: | -4.9189 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 29.6084 |
| InChI Key: | YVTBEWPXJKHGHZ-UHFFFAOYSA-N |