N-(3-{(2,3-dimethoxyphenyl)[(pyridin-2-yl)amino]methyl}-5-methylthiophen-2-yl)furan-2-carboxamide
Chemical Structure Depiction of
N-(3-{(2,3-dimethoxyphenyl)[(pyridin-2-yl)amino]methyl}-5-methylthiophen-2-yl)furan-2-carboxamide
N-(3-{(2,3-dimethoxyphenyl)[(pyridin-2-yl)amino]methyl}-5-methylthiophen-2-yl)furan-2-carboxamide
Compound characteristics
| Compound ID: | D444-0073 |
| Compound Name: | N-(3-{(2,3-dimethoxyphenyl)[(pyridin-2-yl)amino]methyl}-5-methylthiophen-2-yl)furan-2-carboxamide |
| Molecular Weight: | 449.53 |
| Molecular Formula: | C24 H23 N3 O4 S |
| Smiles: | [H]N(C(c1cccc(c1OC)OC)c1cc(C)sc1NC(c1ccco1)=O)c1ccccn1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6895 |
| logD: | 4.6693 |
| logSw: | -4.513 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 65.98 |
| InChI Key: | GKFQXTKAJYBXNU-OAQYLSRUSA-N |