N-(5-methyl-3-{[(4-methylpyridin-2-yl)amino](phenyl)methyl}thiophen-2-yl)benzamide
Chemical Structure Depiction of
N-(5-methyl-3-{[(4-methylpyridin-2-yl)amino](phenyl)methyl}thiophen-2-yl)benzamide
N-(5-methyl-3-{[(4-methylpyridin-2-yl)amino](phenyl)methyl}thiophen-2-yl)benzamide
Compound characteristics
| Compound ID: | D444-0092 |
| Compound Name: | N-(5-methyl-3-{[(4-methylpyridin-2-yl)amino](phenyl)methyl}thiophen-2-yl)benzamide |
| Molecular Weight: | 413.54 |
| Molecular Formula: | C25 H23 N3 O S |
| Smiles: | [H]N(C(c1ccccc1)c1cc(C)sc1NC(c1ccccc1)=O)c1cc(C)ccn1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.6684 |
| logD: | 5.4471 |
| logSw: | -5.4354 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.054 |
| InChI Key: | SLRVOFYDLXBIDT-HSZRJFAPSA-N |