N-(5-methyl-3-{[(4-methylpyridin-2-yl)amino](pyridin-2-yl)methyl}thiophen-2-yl)benzamide
					Chemical Structure Depiction of
N-(5-methyl-3-{[(4-methylpyridin-2-yl)amino](pyridin-2-yl)methyl}thiophen-2-yl)benzamide
			N-(5-methyl-3-{[(4-methylpyridin-2-yl)amino](pyridin-2-yl)methyl}thiophen-2-yl)benzamide
Compound characteristics
| Compound ID: | D444-0122 | 
| Compound Name: | N-(5-methyl-3-{[(4-methylpyridin-2-yl)amino](pyridin-2-yl)methyl}thiophen-2-yl)benzamide | 
| Molecular Weight: | 414.53 | 
| Molecular Formula: | C24 H22 N4 O S | 
| Smiles: | [H]N(C(c1cc(C)sc1NC(c1ccccc1)=O)c1ccccn1)c1cc(C)ccn1 | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 4.5262 | 
| logD: | 4.025 | 
| logSw: | -4.2634 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 51.102 | 
| InChI Key: | GFWWQVGPZIRXSS-QFIPXVFZSA-N | 
 
				 
				