N-(5-methyl-3-{(pyridin-3-yl)[(pyridin-2-yl)amino]methyl}thiophen-2-yl)benzamide
Chemical Structure Depiction of
N-(5-methyl-3-{(pyridin-3-yl)[(pyridin-2-yl)amino]methyl}thiophen-2-yl)benzamide
N-(5-methyl-3-{(pyridin-3-yl)[(pyridin-2-yl)amino]methyl}thiophen-2-yl)benzamide
Compound characteristics
| Compound ID: | D444-0124 |
| Compound Name: | N-(5-methyl-3-{(pyridin-3-yl)[(pyridin-2-yl)amino]methyl}thiophen-2-yl)benzamide |
| Molecular Weight: | 400.5 |
| Molecular Formula: | C23 H20 N4 O S |
| Smiles: | [H]N(C(c1cccnc1)c1cc(C)sc1NC(c1ccccc1)=O)c1ccccn1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2707 |
| logD: | 4.215 |
| logSw: | -4.1597 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.572 |
| InChI Key: | JGHYHFORNVNXSO-OAQYLSRUSA-N |