N-(5-methyl-3-{[4-(methylsulfanyl)phenyl][(pyridin-2-yl)amino]methyl}thiophen-2-yl)benzamide
Chemical Structure Depiction of
N-(5-methyl-3-{[4-(methylsulfanyl)phenyl][(pyridin-2-yl)amino]methyl}thiophen-2-yl)benzamide
N-(5-methyl-3-{[4-(methylsulfanyl)phenyl][(pyridin-2-yl)amino]methyl}thiophen-2-yl)benzamide
Compound characteristics
| Compound ID: | D444-0139 |
| Compound Name: | N-(5-methyl-3-{[4-(methylsulfanyl)phenyl][(pyridin-2-yl)amino]methyl}thiophen-2-yl)benzamide |
| Molecular Weight: | 445.6 |
| Molecular Formula: | C25 H23 N3 O S2 |
| Smiles: | [H]N(C(c1ccc(cc1)SC)c1cc(C)sc1NC(c1ccccc1)=O)c1ccccn1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.066 |
| logD: | 6.0394 |
| logSw: | -5.5551 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.054 |
| InChI Key: | BDXILKVFYDAWKR-HSZRJFAPSA-N |