N-(3-{[(4,6-dimethylpyrimidin-2-yl)amino](3-fluorophenyl)methyl}-5-ethylthiophen-2-yl)benzamide
Chemical Structure Depiction of
N-(3-{[(4,6-dimethylpyrimidin-2-yl)amino](3-fluorophenyl)methyl}-5-ethylthiophen-2-yl)benzamide
N-(3-{[(4,6-dimethylpyrimidin-2-yl)amino](3-fluorophenyl)methyl}-5-ethylthiophen-2-yl)benzamide
Compound characteristics
| Compound ID: | D444-0909 |
| Compound Name: | N-(3-{[(4,6-dimethylpyrimidin-2-yl)amino](3-fluorophenyl)methyl}-5-ethylthiophen-2-yl)benzamide |
| Molecular Weight: | 460.57 |
| Molecular Formula: | C26 H25 F N4 O S |
| Smiles: | [H]N(C(c1cccc(c1)F)c1cc(CC)sc1NC(c1ccccc1)=O)c1nc(C)cc(C)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.5554 |
| logD: | 5.5526 |
| logSw: | -5.4135 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.757 |
| InChI Key: | WRPXNPFNWJFZAE-HSZRJFAPSA-N |