N-(3-{[(4,6-dimethylpyrimidin-2-yl)amino](thiophen-2-yl)methyl}-5-ethylthiophen-2-yl)benzamide
Chemical Structure Depiction of
N-(3-{[(4,6-dimethylpyrimidin-2-yl)amino](thiophen-2-yl)methyl}-5-ethylthiophen-2-yl)benzamide
N-(3-{[(4,6-dimethylpyrimidin-2-yl)amino](thiophen-2-yl)methyl}-5-ethylthiophen-2-yl)benzamide
Compound characteristics
| Compound ID: | D444-0928 |
| Compound Name: | N-(3-{[(4,6-dimethylpyrimidin-2-yl)amino](thiophen-2-yl)methyl}-5-ethylthiophen-2-yl)benzamide |
| Molecular Weight: | 448.61 |
| Molecular Formula: | C24 H24 N4 O S2 |
| Smiles: | [H]N(C(c1cc(CC)sc1NC(c1ccccc1)=O)c1cccs1)c1nc(C)cc(C)n1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0936 |
| logD: | 5.0891 |
| logSw: | -4.883 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.776 |
| InChI Key: | MMTHURAHYARUJI-NRFANRHFSA-N |