rel-(4aR,7aS)-4-butyl-1-(3,4-dimethylphenyl)hexahydro-1H-6lambda~6~-thieno[3,4-b]pyrazine-2,6,6-trione
Chemical Structure Depiction of
rel-(4aR,7aS)-4-butyl-1-(3,4-dimethylphenyl)hexahydro-1H-6lambda~6~-thieno[3,4-b]pyrazine-2,6,6-trione
rel-(4aR,7aS)-4-butyl-1-(3,4-dimethylphenyl)hexahydro-1H-6lambda~6~-thieno[3,4-b]pyrazine-2,6,6-trione
Compound characteristics
| Compound ID: | D445-0965 |
| Compound Name: | rel-(4aR,7aS)-4-butyl-1-(3,4-dimethylphenyl)hexahydro-1H-6lambda~6~-thieno[3,4-b]pyrazine-2,6,6-trione |
| Molecular Weight: | 350.48 |
| Molecular Formula: | C18 H26 N2 O3 S |
| Smiles: | CCCCN1CC(N(c2ccc(C)c(C)c2)[C@@H]2CS(C[C@H]12)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE (RELATIVE) |
| logP: | 2.1332 |
| logD: | 2.1332 |
| logSw: | -2.73 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 47.169 |
| InChI Key: | SFJBITCQBQEFNH-DLBZAZTESA-N |