7-(2-chlorophenyl)-N,N-dimethyl-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Chemical Structure Depiction of
7-(2-chlorophenyl)-N,N-dimethyl-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine
7-(2-chlorophenyl)-N,N-dimethyl-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | D447-0403 |
| Compound Name: | 7-(2-chlorophenyl)-N,N-dimethyl-5-phenyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| Molecular Weight: | 348.83 |
| Molecular Formula: | C20 H17 Cl N4 |
| Smiles: | CN(C)c1c2c(cn(c3ccccc3[Cl])c2ncn1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.8729 |
| logD: | 4.6773 |
| logSw: | -5.116 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 25.2637 |
| InChI Key: | LNXGZKAAYGZNDL-UHFFFAOYSA-N |