2-({6-[(2,5-dimethylphenyl)carbamamido]-1,3-benzothiazol-2-yl}sulfanyl)-N-(2-methylphenyl)acetamide
Chemical Structure Depiction of
2-({6-[(2,5-dimethylphenyl)carbamamido]-1,3-benzothiazol-2-yl}sulfanyl)-N-(2-methylphenyl)acetamide
2-({6-[(2,5-dimethylphenyl)carbamamido]-1,3-benzothiazol-2-yl}sulfanyl)-N-(2-methylphenyl)acetamide
Compound characteristics
| Compound ID: | D451-0775 |
| Compound Name: | 2-({6-[(2,5-dimethylphenyl)carbamamido]-1,3-benzothiazol-2-yl}sulfanyl)-N-(2-methylphenyl)acetamide |
| Molecular Weight: | 476.62 |
| Molecular Formula: | C25 H24 N4 O2 S2 |
| Smiles: | Cc1ccc(C)c(c1)NC(Nc1ccc2c(c1)sc(n2)SCC(Nc1ccccc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6271 |
| logD: | 5.6271 |
| logSw: | -5.3197 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 63.105 |
| InChI Key: | KNNFTYJUOSBKOQ-UHFFFAOYSA-N |